|
제품 상세 정보:
|
| 제품명: | 테트라플루오로테레프탈로니트릴 | 카스: | 1835-49-0 |
|---|---|---|---|
| 아이네크스: | 217-397-3 | 녹는점: | 197-199 °C (점등) |
| 보관 온도: | 2~8°C | 형태: | 단단한 |
| 색상: | 흰색에서 연한 노란색 | ||
| 강조하다: | Tetrafluoroterephthalonitrile biochemical reagent,CAS 1835-49-0 lab chemical,Tetrafluoroterephthalonitrile industrial fine chemical |
||
| Product Name: | 5-Chloro-2-nitrobenzoic acid |
| Synonyms: | 6-Nitro-3-chlorobenzoic acid;5-Chloro-2-nitrobenzoic acid,99%;5-Chloro-2-nitrobenzoic acid, 99% 100GR;5-Chloro-2-nitrobenzoic acid, 99% 10GR;5-CHLORO-2-NITROBENZOIC ACID FOR SYNTHES;2-Carboxy-4-chloronitrobenzene;oro-2-nitrobenzoic acid;RARECHEM AL BO 1106 |
| CAS: | 2516-95-2 |
| MF: | C7H4ClNO4 |
| MW: | 201.56 |
| EINECS: | 219-738-1 |
| Product Categories: | Building Blocks;Carbonyl Compounds;Carboxylic Acids;Chemical Synthesis;Organic Building Blocks;Tolvaptan intermediate;Pharmaceutical Intermediates;Benzene series;Organic acids;C7;Carbonyl Compounds;Carboxylic Acids;FINE Chemical & INTERMEDIATES;Aromatic Carboxylic Acids, Amides, Anilides, Anhydrides & Salts |
| Mol File: | 2516-95-2.mol |
| Product Name: | Tetrafluoroterephthalonitrile |
| Synonyms: | Tetrafluoro-t-phthalonitrile;2,3,5,6-Tetrafluorobenzene-1,4-dicarbonitrile;Tetrafluoroterephthalonitrile,97%;Perfluoroterephthalonitrile 99%;Tetrafluoroterephthalonitrile, 2,3,5,6-Tetrafluorobenzene-1,4-dicarbonitrile, 1,4-Dicyanoperfluorobenzene;2,3,5,6-Tetrafluorobenzene-1,4-dicarbonitrile, Perfluoroterephthalonitrile;2,3,5,6-Tetrafluoro-1,4-dicyanobenzene;2,4,5,6-Tetrafluorobenzene-1,4-dicarbonitrile |
| CAS: | 1835-49-0 |
| MF: | C8F4N2 |
| MW: | 200.09 |
| EINECS: | 217-397-3 |
| Product Categories: | Nitrogen Compounds;Nitrile;C8 to C9;Cyanides/Nitriles;OLED |
| Mol File: | 1835-49-0.mol |
| Tetrafluoroterephthalonitrile Chemical Properties |
| Melting point | 197-199 °C (lit.) |
| Boiling point | 243.3±40.0 °C(Predicted) |
| density | 1.6184 (estimate) |
| storage temp. | 2-8°C |
| solubility | Soluble in hot methanol. |
| form | Solid |
| color | White to Light yellow |
| InChI | InChI=1S/C8F4N2/c9-5-3(1-13)6(10)8(12)4(2-14)7(5)11 |
| InChIKey | PCRSJGWFEMHHEW-UHFFFAOYSA-N |
| SMILES | C1(C#N)=C(F)C(F)=C(C#N)C(F)=C1F |
| CAS DataBase Reference | 1835-49-0(CAS DataBase Reference) |
| NIST Chemistry Reference | 1,4-Benzenedicarbonitrile, 2,3,5,6-tetrafluoro-(1835-49-0) |
| EPA Substance Registry System | Tetrafluoroterephthalonitrile (1835-49-0) |
 |
담당자: Maggie Ma
전화 번호: +0086 188 7414 9531
Korean
