|
제품 상세 정보:
|
| 제품명: | 4,4'-(1-페닐에틸리덴)비페놀 | 카스: | 1571-75-1 |
|---|---|---|---|
| 아이넥스: | 433-130-5 | 녹는점: | 188-191 °C (점등) |
| 보관 온도: | 보관온도 2~8°C | 형태: | 가루 |
| 색상: | 거의 희게 하도록 하얗습니다 | ||
| 강조하다: | 4,4'-(1-Phenylethylidene) biphenol biochemical reagent,CAS 1571-75-1 biochemical reagent,industrial fine chemical reagent |
||
| 4,4'-(1-Phenylethylidene) biphenol Basic information |
| Product Name: | 4,4'-(1-Phenylethylidene) biphenol |
| Synonyms: | 1,1-Bis(4-hydroxyphenyl)-1-phenylethane 4,4'-(1-Phenylethylidene)diphenol;4,4'-(1-Phenylethylidene)bisphenol 99%;IFLAB-BB F0701-0005;BISPHENOL AP;4,4'-(1-PHENYLETHYLIDENE)DIPHENOL;4,4'-(1-ALPHA-METHYLBENZYLIDENE)BISPHENOL;4,4'-(ALPHA-METHYLBENZYLIDENE)BISPHENOL;4,4'-(ALPHA-METHYLBENZYLIDENE)DIPHENOL |
| CAS: | 1571-75-1 |
| MF: | C20H18O2 |
| MW: | 290.36 |
| EINECS: | 433-130-5 |
| Product Categories: | API intermediates;Fluorenes, etc. (reagent for high-performance polymer research);Functional Materials;Reagent for High-Performance Polymer Research;Industrial/Fine Chemicals;Phenoles and thiophenoles |
| Mol File: | 1571-75-1.mol |
 |
|
| 4,4'-(1-Phenylethylidene) biphenol Chemical Properties |
| Melting point | 188-191 °C (lit.) |
| Boiling point | 473.8±35.0 °C(Predicted) |
| density | 1.179±0.06 g/cm3(Predicted) |
| storage temp. | Storage temp. 2-8°C |
| solubility | almost transparency in Methanol |
| pka | 10.22±0.10(Predicted) |
| color | White to Almost white |
| InChI | InChI=1S/C20H18O2/c1-20(15-5-3-2-4-6-15,16-7-11-18(21)12-8-16)17-9-13-19(22)14-10-17/h2-14,21-22H,1H3 |
| InChIKey | VOWWYDCFAISREI-UHFFFAOYSA-N |
| SMILES | C(C1=CC=C(O)C=C1)(C1=CC=C(O)C=C1)(C1=CC=CC=C1)C |
담당자: Maggie Ma
전화 번호: +0086 188 7414 9531
