|
제품 상세 정보:
|
| 제품명: | 2-(디페닐포스피노)벤조산 | 카스: | 17261-28-8 |
|---|---|---|---|
| 아이넥스: | 241-293-7 | 녹는점: | 174-181 °C (점등) |
| 보관 온도: | 불활성 분위기, 실내 온도 | 형태: | 가루 |
| 색상: | 연한 노란색 | ||
| 강조하다: | 2-(Diphenylphosphino)benzoic acid lab reagent,CAS 17261-28-8 biochemical reagent,industrial fine chemical with warranty |
||
CAS 17261-28-8 2-(Diphenylphosphino)benzoic acid biochemical reagent for labs
| Product Name: | 2-(Diphenylphosphino)benzoic acid |
| Synonyms: | 2-(DIPHENYLPHOSPHINO)BENZOIC ACID;2-(diphenylphosphino)-benzoicaci;2-Diphenylphosphanyl-benzoicacid;2-Diphenylphosphinobenzoes?ure;2-(DiphenyL;phosphino)benzoic acid;O-(DIPHENYLPHOSPHINO)BENZOIC ACID;DPPBAC/2-DIPHENYLPHOSPHINOBENZOIC ACID |
| CAS: | 17261-28-8 |
| MF: | C19H15O2P |
| MW: | 306.3 |
| EINECS: | 241-293-7 |
| Product Categories: | TOP1;phosphine ligand;Catalysis and Inorganic Chemistry;Phosphine Ligands;Phosphorus Compounds;Phosphine Ligands;Synthetic Organic Chemistry;Achiral Phosphine;Aryl Phosphine |
| Mol File: | 17261-28-8.mol |
 |
|
| 2-(Diphenylphosphino)benzoic acid Chemical Properties |
| Melting point | 174-181 °C (lit.) |
| Boiling point | 159 °C |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | Chloroform (Slightly), DMSO (Slightly), Methanol (Slightly) |
| pka | 3.72±0.36(Predicted) |
| form | Powder |
| color | Light yellow |
| Stability: | Hygroscopic |
| InChI | InChI=1S/C19H15O2P/c20-19(21)17-13-7-8-14-18(17)22(15-9-3-1-4-10-15)16-11-5-2-6-12-16/h1-14H,(H,20,21) |
| InChIKey | UYRPRYSDOVYCOU-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC=CC=C1P(C1=CC=CC=C1)C1=CC=CC=C1 |
| CAS DataBase Reference | 17261-28-8(CAS DataBase Reference) |
| EPA Substance Registry System | Benzoic acid, 2-(diphenylphosphino)- (17261-28-8) |
담당자: Maggie Ma
전화 번호: +0086 188 7414 9531
Korean
