|
제품 상세 정보:
|
| 제품명: | 구아닌 | 카스: | 73-40-5 |
|---|---|---|---|
| 아이네크스: | 200-799-8 | 녹는점: | 'Ｃ (밝혀진 >300.) |
| 스토리지 온도.: | 2-8 ° C | 형태: | 가루 |
| 색상: | 크림이 일도록 하얗습니다 | ||
| 강조하다: | Guanine biological reagent CAS 73-40-5,Industrial fine chemical guanine,High purity guanine reagent |
||
CAS 73-40-5 Guanine
| Guanine Basic information |
| Product Name: | Guanine |
| Synonyms: | 2-AMino-6-hydroxy-1H-purine;9H-Guanine;Valaciclovir EP Impurity A;Guanine Vetec(TM) reagent grade, 99%;6H-Purin-6-one, 2-amino-1,7-dihydro- (9CI);6H-purin-6-one, 2-amino-3,7-dihydro-;Guanine (8CI);InChI=1/C5H5N5O/c6-5-9-3-2(4(11)10-5)7-1-8-3/h1H,(H4,6,7,8,9,10,11 |
| CAS: | 73-40-5 |
| MF: | C5H5N5O |
| MW: | 151.13 |
| EINECS: | 200-799-8 |
| Product Categories: | Acyclovir;Biochemistry;Nucleobases and their analogs;Nucleosides, Nucleotides & Related Reagents;Nucleic acids;Bases & Related Reagents;Nucleotides;Purines;nucleoside;API;Purine;Pharmaceutical Intermediates;Intermediates;john's |
| Mol File: | 73-40-5.mol |
 |
|
| Guanine Chemical Properties |
| Melting point | >300 °C (lit.) |
| Boiling point | 273.11°C (rough estimate) |
| density | 1.4456 (rough estimate) |
| refractive index | 2.0000 (estimate) |
| storage temp. | 2-8°C |
| solubility | 1 M NaOH: 0.1 M at 20 °C, clear, colorless |
| form | Powder |
| pka | 9.92(at 40℃) |
| color | White to cream |
| Odor | Odorless |
| biological source | synthetic (organic) |
| Water Solubility | practically insoluble |
| Decomposition | 360°C |
담당자: Maggie Ma
전화 번호: +0086 188 7414 9531
