|
제품 상세 정보:
|
| 제품 이름: | CI 50206 | 카스: | 4569-86-2 |
|---|---|---|---|
| 형태: | 단단한 | 색상: | 매우 어두운 파란색에서 검은색 |
| 스토리지 온도.: | 방 온도 | Einecs: | 610-268-6 |
| 녹는 점: | 285 °C (dec.) | ||
| 강조하다: | CAS 4569-86-2 biological reagents,CI 50206 industrial fine chemicals,biological reagents with warranty |
||
CAS 4569-86-2 CI 50206 biological reagents
| Product Name: | CI 50206 |
| Synonyms: | Methylene violet 3rax, pure;2-Amino-8-(diethylamino)-10-phenylphenazine-10-ium·chloride;3-Amino-7-(diethylamino)-5-phenyl phenazinium chloride, 3-Amino-7-(diethylamino)-5-phenylphenazinium chloride, N,N-Diethylphenosafranine;Methylene violet 3RAX, Dye content 90%;PhenaziniuM,3-aMino-7-(diethylaMino)-5-phenyl-, chloride (1:1);N,N-DIETHYLPHENOSAFRANINE;Phenazinium,3-amino-7-(diethylamino)-5-phenyl-,chloride;3-AMINO-7-DIETHYLAMINO-5-PHENYL-PHENAZIN-5-IUM CHLORIDE |
| CAS: | 4569-86-2 |
| MF: | C22H23ClN4 |
| MW: | 378.9 |
| EINECS: | 610-268-6 |
| Product Categories: | |
| Mol File: | 4569-86-2.mol |
 |
|
| CI 50206 Chemical Properties |
| Melting point | 285 °C (dec.)(lit.) |
| storage temp. | room temp |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| Colour Index | 50206 |
| color | Very Dark Blue to Black |
| λmax | 557 nm |
| InChI | InChI=1S/C22H22N4.ClH/c1-3-25(4-2)18-11-13-20-22(15-18)26(17-8-6-5-7-9-17)21-14-16(23)10-12-19(21)24-20;/h5-15,23H,3-4H2,1-2H3;1H |
| InChIKey | MOVNSGGBTSIUGX-UHFFFAOYSA-N |
| SMILES | N(C1C=CC2=NC3=CC=C(N)C=C3[N+](C3C=CC=CC=3)=C2C=1)(CC)CC.[Cl-] |
| CAS DataBase Reference | 4569-86-2(CAS DataBase Reference) |
담당자: Maggie Ma
전화 번호: +0086 188 7414 9531
