| 
                     
                        제품 상세 정보:
                                                     
                
 
  | 
                    
| 제품 이름: | 페니실린 G 칼륨 소금 | 카스: | 113-98-4 | 
|---|---|---|---|
| 형태: | 가루 | 색상: | 부탄올의 바늘 (aq) | 
| 스토리지 온도.: | 건조로 밀봉 된 냉동고에 -20 ° C 미만으로 보관하십시오 | Einecs: | 204-038-0 | 
| 녹는 점: | 214-217 c | 
CAS 113-98-4 Penicillin G potassium salt
| Penicillin G potassium salt Basic information | 
| Product Name: | Penicillin G potassium salt | 
| Synonyms: | tabilin;PENICILLIN G K-SALT;PENICILLIN G POTASSIUM SALT;PENICILLIN G POTASSIUM;potassium [2s-(2alpha,5alpha,6beta)]-3,3-dimethyl-7-oxo-6-(phenylacetamido)-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate;potassium benzylpenicillin;4-Thia-1-azabicyclo;4-Thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid, 3,3-dimethyl-7-oxo-6-[(phenylacetyl)amino]-, [2S-(2alpha,5alpha,6beta)]-, monopotassium salt | 
| CAS: | 113-98-4 | 
| MF: | C16H17KN2O4S | 
| MW: | 372.48 | 
| EINECS: | 204-038-0 | 
| Product Categories: | Heterocycles;Intermediates & Fine Chemicals;Antibiotics for Research and Experimental Use;API's;Pharmaceuticals;Sulfur & Selenium Compounds;beta-Lactams (Antibiotics for Research and Experimental Use);Biochemistry;113-98-4 | 
| Mol File: | 113-98-4.mol | 
| Penicillin G potassium salt Chemical Properties | 
| Melting point | 214-217 C | 
| alpha | D22 +285° (c = 0.748 in water) | 
| refractive index | 294 ° (C=1, H2O) | 
| storage temp. | Sealed in dry,Store in freezer, under -20°C | 
| solubility | H2O: 100 mg/mL | 
| form | powder | 
| color | Needles from butanol (aq) | 
| PH | pH (10g/L, 25℃) : 5.0~7.5 | 
| Water Solubility | Soluble in water (100 mg/ml), methanol, ethanol (sparingly), and alcohol. Insoluble in chloroform. | 
| BRN | 3832841 | 
| Stability: | Hygroscopic | 
| InChIKey | IYNDLOXRXUOGIU-LQDWTQKMSA-M | 
| SMILES | N12C([C@@H](NC(=O)CC3=CC=CC=C3)[C@@]1([H])SC(C)(C)[C@@H]2C([O-])=O)=O.[K+] |&1:2,13,19,r| | 
| EPA Substance Registry System | Penicillin G Potassium (113-98-4) | 
| Safety Information | 
| Hazard Codes | Xn,C,F | 
| Risk Statements | 42/43-34-11 | 
| Safety Statements | 36/37-45-36/37/39-26-16-60-37-24-22 | 
| WGK Germany | 2 | 
| RTECS | XH9700000 | 
| F | 10-23 | 
| TSCA | Yes | 
| HS Code | 29411000 | 
| Toxicity | LD50 oral in rabbit: 5848mg/kg | 
![]()
담당자: Maggie Ma
전화 번호: +0086 188 7414 9531